C10H20N2S — CID 135934584
4-ethyl-N-pentyl-1,3-thiazolidin-2-imine (PubChem CID 135934584) has the molecular formula C10H20N2S and a molecular weight of 200.35 g/mol. Its IUPAC name is 4-ethyl-N-pentyl-1,3-thiazolidin-2-imine.
| Compound Name | 4-ethyl-N-pentyl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 135934584 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 4-ethyl-N-pentyl-1,3-thiazolidin-2-imine |
| SMILES | CCCCC/N=C1/NC(CC)CS1 |
| InChI | InChI=1S/C10H20N2S/c1-3-5-6-7-11-10-12-9(4-2)8-13-10/h9H,3-8H2,1-2H3,(H,11,12) |
| InChIKey | POALSKWYPVRHBP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|