C12H25N3S — CID 135934622
N,N-diethyl-3-[(4-ethyl-1,3-thiazolidin-2-ylidene)amino]propan-1-amine (PubChem CID 135934622) has the molecular formula C12H25N3S and a molecular weight of 243.42 g/mol. Its IUPAC name is N,N-diethyl-3-[(4-ethyl-1,3-thiazolidin-2-ylidene)amino]propan-1-amine.
| Compound Name | N,N-diethyl-3-[(4-ethyl-1,3-thiazolidin-2-ylidene)amino]propan-1-amine |
|---|---|
| PubChem CID | 135934622 |
| Molecular Formula | C12H25N3S |
| Molecular Weight | 243.42 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | N,N-diethyl-3-[(4-ethyl-1,3-thiazolidin-2-ylidene)amino]propan-1-amine |
| SMILES | CCC1CS/C(=N\CCCN(CC)CC)N1 |
| InChI | InChI=1S/C12H25N3S/c1-4-11-10-16-12(14-11)13-8-7-9-15(5-2)6-3/h11H,4-10H2,1-3H3,(H,13,14) |
| InChIKey | VRDQXOLDOSWDRQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|