C12H23N3O2S2 — CID 136769034
3-[[(3aR,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-d][1,3]thiazol-2-ylidene]amino]-N,N-diethylpropan-1-amine (PubChem CID 136769034) has the molecular formula C12H23N3O2S2 and a molecular weight of 305.47 g/mol. Its IUPAC name is 3-[[(3aR,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-d][1,3]thiazol-2-ylidene]amino]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[[(3aR,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-d][1,3]thiazol-2-ylidene]amino]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 136769034 |
| Molecular Formula | C12H23N3O2S2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 3-[[(3aR,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydro-3H-thieno[3,4-d][1,3]thiazol-2-ylidene]amino]-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCC/N=C1/N[C@@H]2CS(=O)(=O)C[C@@H]2S1 |
| InChI | InChI=1S/C12H23N3O2S2/c1-3-15(4-2)7-5-6-13-12-14-10-8-19(16,17)9-11(10)18-12/h10-11H,3-9H2,1-2H3,(H,13,14)/t10-,11+/m1/s1 |
| InChIKey | OYHMKDWDQAWHLY-MNOVXSKESA-N |
| XLogP | 0.58 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|