C12H23N3OS — CID 135410249
3-(diethylamino)-1-(4-methyl-2-methylimino-1,3-thiazolidin-5-yl)propan-1-one (PubChem CID 135410249) has the molecular formula C12H23N3OS and a molecular weight of 257.40 g/mol. Its IUPAC name is 3-(diethylamino)-1-(4-methyl-2-methylimino-1,3-thiazolidin-5-yl)propan-1-one.
| Compound Name | 3-(diethylamino)-1-(4-methyl-2-methylimino-1,3-thiazolidin-5-yl)propan-1-one |
|---|---|
| PubChem CID | 135410249 |
| Molecular Formula | C12H23N3OS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 3-(diethylamino)-1-(4-methyl-2-methylimino-1,3-thiazolidin-5-yl)propan-1-one |
| SMILES | CCN(CC)CCC(=O)C1S/C(=N\C)NC1C |
| InChI | InChI=1S/C12H23N3OS/c1-5-15(6-2)8-7-10(16)11-9(3)14-12(13-4)17-11/h9,11H,5-8H2,1-4H3,(H,13,14) |
| InChIKey | IIKZQNRYUMUKSE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|