C13H27N3S — CID 136666999
N-[2-[(4,6-dimethyl-1,3-thiazinan-2-ylidene)amino]ethyl]-N-ethylpropan-1-amine (PubChem CID 136666999) has the molecular formula C13H27N3S and a molecular weight of 257.45 g/mol. Its IUPAC name is N-[2-[(4,6-dimethyl-1,3-thiazinan-2-ylidene)amino]ethyl]-N-ethylpropan-1-amine.
| Compound Name | N-[2-[(4,6-dimethyl-1,3-thiazinan-2-ylidene)amino]ethyl]-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 136666999 |
| Molecular Formula | C13H27N3S |
| Molecular Weight | 257.45 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | N-[2-[(4,6-dimethyl-1,3-thiazinan-2-ylidene)amino]ethyl]-N-ethylpropan-1-amine |
| SMILES | CCCN(CC)CC/N=C1/NC(C)CC(C)S1 |
| InChI | InChI=1S/C13H27N3S/c1-5-8-16(6-2)9-7-14-13-15-11(3)10-12(4)17-13/h11-12H,5-10H2,1-4H3,(H,14,15) |
| InChIKey | IWYBNVAWUXXSLX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|