C10H20N2OS — CID 136755273
N-(3-methoxypropyl)-4,6-dimethyl-1,3-thiazinan-2-imine (PubChem CID 136755273) has the molecular formula C10H20N2OS and a molecular weight of 216.35 g/mol. Its IUPAC name is N-(3-methoxypropyl)-4,6-dimethyl-1,3-thiazinan-2-imine.
| Compound Name | N-(3-methoxypropyl)-4,6-dimethyl-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136755273 |
| Molecular Formula | C10H20N2OS |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | N-(3-methoxypropyl)-4,6-dimethyl-1,3-thiazinan-2-imine |
| SMILES | COCCC/N=C1/NC(C)CC(C)S1 |
| InChI | InChI=1S/C10H20N2OS/c1-8-7-9(2)14-10(12-8)11-5-4-6-13-3/h8-9H,4-7H2,1-3H3,(H,11,12) |
| InChIKey | ZCXPCHTUZGYIBM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|