C9H16F2N2S — CID 137216588
N-(3,3-difluoropropyl)-4,6-dimethyl-1,3-thiazinan-2-imine (PubChem CID 137216588) has the molecular formula C9H16F2N2S and a molecular weight of 222.30 g/mol. Its IUPAC name is N-(3,3-difluoropropyl)-4,6-dimethyl-1,3-thiazinan-2-imine.
| Compound Name | N-(3,3-difluoropropyl)-4,6-dimethyl-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 137216588 |
| Molecular Formula | C9H16F2N2S |
| Molecular Weight | 222.30 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | N-(3,3-difluoropropyl)-4,6-dimethyl-1,3-thiazinan-2-imine |
| SMILES | CC1CC(C)S/C(=N\CCC(F)F)N1 |
| InChI | InChI=1S/C9H16F2N2S/c1-6-5-7(2)14-9(13-6)12-4-3-8(10)11/h6-8H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | JDDWKGUDLGBRBO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|