C9H17N3OS — CID 136755278
2-[(4,6-dimethyl-1,3-thiazinan-2-ylidene)amino]-N-methylacetamide (PubChem CID 136755278) has the molecular formula C9H17N3OS and a molecular weight of 215.32 g/mol. Its IUPAC name is 2-[(4,6-dimethyl-1,3-thiazinan-2-ylidene)amino]-N-methylacetamide.
| Compound Name | 2-[(4,6-dimethyl-1,3-thiazinan-2-ylidene)amino]-N-methylacetamide |
|---|---|
| PubChem CID | 136755278 |
| Molecular Formula | C9H17N3OS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2-[(4,6-dimethyl-1,3-thiazinan-2-ylidene)amino]-N-methylacetamide |
| SMILES | CNC(=O)C/N=C1/NC(C)CC(C)S1 |
| InChI | InChI=1S/C9H17N3OS/c1-6-4-7(2)14-9(12-6)11-5-8(13)10-3/h6-7H,4-5H2,1-3H3,(H,10,13)(H,11,12) |
| InChIKey | SRGUCEIPNOAHIC-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|