C11H22N2O2S2 — CID 136755447
4,6-dimethyl-N-(2-methyl-2-methylsulfonylpropyl)-1,3-thiazinan-2-imine (PubChem CID 136755447) has the molecular formula C11H22N2O2S2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 4,6-dimethyl-N-(2-methyl-2-methylsulfonylpropyl)-1,3-thiazinan-2-imine.
| Compound Name | 4,6-dimethyl-N-(2-methyl-2-methylsulfonylpropyl)-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136755447 |
| Molecular Formula | C11H22N2O2S2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 4,6-dimethyl-N-(2-methyl-2-methylsulfonylpropyl)-1,3-thiazinan-2-imine |
| SMILES | CC1CC(C)S/C(=N\CC(C)(C)S(C)(=O)=O)N1 |
| InChI | InChI=1S/C11H22N2O2S2/c1-8-6-9(2)16-10(13-8)12-7-11(3,4)17(5,14)15/h8-9H,6-7H2,1-5H3,(H,12,13) |
| InChIKey | GZRBMJALLRFTKN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|