C13H25N3OS — CID 136755275
4,6-dimethyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazinan-2-imine (PubChem CID 136755275) has the molecular formula C13H25N3OS and a molecular weight of 271.43 g/mol. Its IUPAC name is 4,6-dimethyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazinan-2-imine.
| Compound Name | 4,6-dimethyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136755275 |
| Molecular Formula | C13H25N3OS |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 4,6-dimethyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazinan-2-imine |
| SMILES | CC1CC(C)S/C(=N\CCCN2CCOCC2)N1 |
| InChI | InChI=1S/C13H25N3OS/c1-11-10-12(2)18-13(15-11)14-4-3-5-16-6-8-17-9-7-16/h11-12H,3-10H2,1-2H3,(H,14,15) |
| InChIKey | WRVBQGARLSGNFF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|