C15H29N3OS — CID 136848061
4-tert-butyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazinan-2-imine (PubChem CID 136848061) has the molecular formula C15H29N3OS and a molecular weight of 299.48 g/mol. Its IUPAC name is 4-tert-butyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazinan-2-imine.
| Compound Name | 4-tert-butyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136848061 |
| Molecular Formula | C15H29N3OS |
| Molecular Weight | 299.48 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 4-tert-butyl-N-(3-morpholin-4-ylpropyl)-1,3-thiazinan-2-imine |
| SMILES | CC(C)(C)C1CCS/C(=N\CCCN2CCOCC2)N1 |
| InChI | InChI=1S/C15H29N3OS/c1-15(2,3)13-5-12-20-14(17-13)16-6-4-7-18-8-10-19-11-9-18/h13H,4-12H2,1-3H3,(H,16,17) |
| InChIKey | RZHGXOBEOFLTJY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.48 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|