C10H19N3OS — CID 135934635
4-methyl-N-(2-morpholin-4-ylethyl)-1,3-thiazolidin-2-imine (PubChem CID 135934635) has the molecular formula C10H19N3OS and a molecular weight of 229.35 g/mol. Its IUPAC name is 4-methyl-N-(2-morpholin-4-ylethyl)-1,3-thiazolidin-2-imine.
| Compound Name | 4-methyl-N-(2-morpholin-4-ylethyl)-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 135934635 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 4-methyl-N-(2-morpholin-4-ylethyl)-1,3-thiazolidin-2-imine |
| SMILES | CC1CS/C(=N\CCN2CCOCC2)N1 |
| InChI | InChI=1S/C10H19N3OS/c1-9-8-15-10(12-9)11-2-3-13-4-6-14-7-5-13/h9H,2-8H2,1H3,(H,11,12) |
| InChIKey | LHMPMVJUUNBBNS-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|