C8H13F3N2S — CID 136952786
4-methyl-N-(4,4,4-trifluorobutyl)-1,3-thiazolidin-2-imine (PubChem CID 136952786) has the molecular formula C8H13F3N2S and a molecular weight of 226.27 g/mol. Its IUPAC name is 4-methyl-N-(4,4,4-trifluorobutyl)-1,3-thiazolidin-2-imine.
| Compound Name | 4-methyl-N-(4,4,4-trifluorobutyl)-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 136952786 |
| Molecular Formula | C8H13F3N2S |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 4-methyl-N-(4,4,4-trifluorobutyl)-1,3-thiazolidin-2-imine |
| SMILES | CC1CS/C(=N\CCCC(F)(F)F)N1 |
| InChI | InChI=1S/C8H13F3N2S/c1-6-5-14-7(13-6)12-4-2-3-8(9,10)11/h6H,2-5H2,1H3,(H,12,13) |
| InChIKey | PIZGVPSMULUEDJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|