C13H25N3S — CID 136948806
4,5-dimethyl-N-(3-pyrrolidin-1-ylpropyl)-1,3-thiazinan-2-imine (PubChem CID 136948806) has the molecular formula C13H25N3S and a molecular weight of 255.43 g/mol. Its IUPAC name is 4,5-dimethyl-N-(3-pyrrolidin-1-ylpropyl)-1,3-thiazinan-2-imine.
| Compound Name | 4,5-dimethyl-N-(3-pyrrolidin-1-ylpropyl)-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136948806 |
| Molecular Formula | C13H25N3S |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 4,5-dimethyl-N-(3-pyrrolidin-1-ylpropyl)-1,3-thiazinan-2-imine |
| SMILES | CC1CS/C(=N\CCCN2CCCC2)NC1C |
| InChI | InChI=1S/C13H25N3S/c1-11-10-17-13(15-12(11)2)14-6-5-9-16-7-3-4-8-16/h11-12H,3-10H2,1-2H3,(H,14,15) |
| InChIKey | HMFLBJDPZNNLPG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|