C12H25N3S — CID 136948772
4-[(4,5-dimethyl-1,3-thiazinan-2-ylidene)amino]-N,N-dimethylbutan-1-amine (PubChem CID 136948772) has the molecular formula C12H25N3S and a molecular weight of 243.42 g/mol. Its IUPAC name is 4-[(4,5-dimethyl-1,3-thiazinan-2-ylidene)amino]-N,N-dimethylbutan-1-amine.
| Compound Name | 4-[(4,5-dimethyl-1,3-thiazinan-2-ylidene)amino]-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 136948772 |
| Molecular Formula | C12H25N3S |
| Molecular Weight | 243.42 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 4-[(4,5-dimethyl-1,3-thiazinan-2-ylidene)amino]-N,N-dimethylbutan-1-amine |
| SMILES | CC1CS/C(=N\CCCCN(C)C)NC1C |
| InChI | InChI=1S/C12H25N3S/c1-10-9-16-12(14-11(10)2)13-7-5-6-8-15(3)4/h10-11H,5-9H2,1-4H3,(H,13,14) |
| InChIKey | AOFKNFWSLBEWSC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|