C11H19N5S — CID 137002762
4,5-dimethyl-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3-thiazinan-2-imine (PubChem CID 137002762) has the molecular formula C11H19N5S and a molecular weight of 253.37 g/mol. Its IUPAC name is 4,5-dimethyl-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3-thiazinan-2-imine.
| Compound Name | 4,5-dimethyl-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 137002762 |
| Molecular Formula | C11H19N5S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 4,5-dimethyl-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]-1,3-thiazinan-2-imine |
| SMILES | CC1CS/C(=N\CCc2nncn2C)NC1C |
| InChI | InChI=1S/C11H19N5S/c1-8-6-17-11(14-9(8)2)12-5-4-10-15-13-7-16(10)3/h7-9H,4-6H2,1-3H3,(H,12,14) |
| InChIKey | BEYYAUPFDULDSJ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|