C11H17N3S2 — CID 136948814
4,5-dimethyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1,3-thiazinan-2-imine (PubChem CID 136948814) has the molecular formula C11H17N3S2 and a molecular weight of 255.41 g/mol. Its IUPAC name is 4,5-dimethyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1,3-thiazinan-2-imine.
| Compound Name | 4,5-dimethyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136948814 |
| Molecular Formula | C11H17N3S2 |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 4,5-dimethyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1,3-thiazinan-2-imine |
| SMILES | Cc1ncsc1C/N=C1/NC(C)C(C)CS1 |
| InChI | InChI=1S/C11H17N3S2/c1-7-5-15-11(14-8(7)2)12-4-10-9(3)13-6-16-10/h6-8H,4-5H2,1-3H3,(H,12,14) |
| InChIKey | HUWRPIMWASCKPQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|