C6H8N4S — CID 54670922
5-(2-azidoethyl)-4-methyl-1,3-thiazole (PubChem CID 54670922) has the molecular formula C6H8N4S and a molecular weight of 168.22 g/mol. Its IUPAC name is 5-(2-azidoethyl)-4-methyl-1,3-thiazole.
| Compound Name | 5-(2-azidoethyl)-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 54670922 |
| Molecular Formula | C6H8N4S |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 5-(2-azidoethyl)-4-methyl-1,3-thiazole |
| SMILES | Cc1ncsc1CCN=[N+]=[N-] |
| InChI | InChI=1S/C6H8N4S/c1-5-6(11-4-8-5)2-3-9-10-7/h4H,2-3H2,1H3 |
| InChIKey | OGMZROQNZDNMTQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 61.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|