C10H17N3OS — CID 110747837
1-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-3-propylurea (PubChem CID 110747837) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is 1-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-3-propylurea.
| Compound Name | 1-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-3-propylurea |
|---|---|
| PubChem CID | 110747837 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 1-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-3-propylurea |
| SMILES | CCCNC(=O)NCCc1scnc1C |
| InChI | InChI=1S/C10H17N3OS/c1-3-5-11-10(14)12-6-4-9-8(2)13-7-15-9/h7H,3-6H2,1-2H3,(H2,11,12,14) |
| InChIKey | OXRMAOZMAZOPCY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |