C14H17N3O3S2 — CID 110747836
1-(4-methylphenyl)sulfonyl-3-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]urea (PubChem CID 110747836) has the molecular formula C14H17N3O3S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-3-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]urea.
| Compound Name | 1-(4-methylphenyl)sulfonyl-3-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]urea |
|---|---|
| PubChem CID | 110747836 |
| Molecular Formula | C14H17N3O3S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-3-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]urea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)NCCc2scnc2C)cc1 |
| InChI | InChI=1S/C14H17N3O3S2/c1-10-3-5-12(6-4-10)22(19,20)17-14(18)15-8-7-13-11(2)16-9-21-13/h3-6,9H,7-8H2,1-2H3,(H2,15,17,18) |
| InChIKey | GVYHPIKBLBYUOK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |