2-[2-(4-methyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid

C11H18N2O2S — CID 62071360

IUPAC2-[2-(4-methyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid
SMILESCCCC(NCCc1scnc1C)C(=O)O
InChIInChI=1S/C11H18N2O2S/c1-3-4-9(11(14)15)12-6-5-10-8(2)13-7-16-10/h7,9,12H,3-6H2,1-2H3,(H,14,15)
InChIKeyNTGIFUZHVAJJOU-UHFFFAOYSA-N
MW242.34 g/mol
LogP1.84
Rot. Bonds7

About 2-[2-(4-methyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid

2-[2-(4-methyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid (PubChem CID 62071360) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 2-[2-(4-methyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid.

Molecular Properties

Compound Name2-[2-(4-methyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid
PubChem CID62071360
Molecular FormulaC11H18N2O2S
Molecular Weight242.34 g/mol
Exact Mass242.11
IUPAC Name2-[2-(4-methyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid
SMILESCCCC(NCCc1scnc1C)C(=O)O
InChIInChI=1S/C11H18N2O2S/c1-3-4-9(11(14)15)12-6-5-10-8(2)13-7-16-10/h7,9,12H,3-6H2,1-2H3,(H,14,15)
InChIKeyNTGIFUZHVAJJOU-UHFFFAOYSA-N
XLogP1.84
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.34
LogP ≤ 51.84
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[2-(4-methyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(4-methyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid?
The IUPAC name of 2-[2-(4-methyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid (CID 62071360) is 2-[2-(4-methyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid.
What is the SMILES notation for 2-[2-(4-methyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid?
The canonical SMILES for 2-[2-(4-methyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid is CCCC(NCCc1scnc1C)C(=O)O.
What is the InChIKey of 2-[2-(4-methyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid?
The InChIKey is NTGIFUZHVAJJOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2S/c1-3-4-9(11(14)15)12-6-5-10-8(2)13-7-16-10/h7,9,12H,3-6H2,1-2H3,(H,14,15).
What are the key properties of 2-[2-(4-methyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid?
2-[2-(4-methyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid has a molecular weight of 242.34 g/mol, XLogP of 1.84, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-methyl-1,3-thiazol-5-yl)ethylamino]pentanoic acid is sourced from PubChem (CID 62071360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).