C9H14N2O2S — CID 102765838
2-(4-methyl-1,3-thiazol-5-yl)-2-(propylamino)acetic acid (PubChem CID 102765838) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-5-yl)-2-(propylamino)acetic acid.
| Compound Name | 2-(4-methyl-1,3-thiazol-5-yl)-2-(propylamino)acetic acid |
|---|---|
| PubChem CID | 102765838 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-5-yl)-2-(propylamino)acetic acid |
| SMILES | CCCNC(C(=O)O)c1scnc1C |
| InChI | InChI=1S/C9H14N2O2S/c1-3-4-10-7(9(12)13)8-6(2)11-5-14-8/h5,7,10H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | OCRJVLPQAAOCEO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |