C6H7NO2S2 — CID 21298330
2-(4-methyl-1,3-thiazol-5-yl)-2-sulfanylacetic acid (PubChem CID 21298330) has the molecular formula C6H7NO2S2 and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-5-yl)-2-sulfanylacetic acid.
| Compound Name | 2-(4-methyl-1,3-thiazol-5-yl)-2-sulfanylacetic acid |
|---|---|
| PubChem CID | 21298330 |
| Molecular Formula | C6H7NO2S2 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 188.99 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-5-yl)-2-sulfanylacetic acid |
| SMILES | Cc1ncsc1C(S)C(=O)O |
| InChI | InChI=1S/C6H7NO2S2/c1-3-5(11-2-7-3)4(10)6(8)9/h2,4,10H,1H3,(H,8,9) |
| InChIKey | LZOMRFMEUDZCKK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|