2-(4-methyl-1,3-thiazol-5-yl)-2-sulfanylacetic acid

C6H7NO2S2 — CID 21298330

IUPAC2-(4-methyl-1,3-thiazol-5-yl)-2-sulfanylacetic acid
SMILESCc1ncsc1C(S)C(=O)O
InChIInChI=1S/C6H7NO2S2/c1-3-5(11-2-7-3)4(10)6(8)9/h2,4,10H,1H3,(H,8,9)
InChIKeyLZOMRFMEUDZCKK-UHFFFAOYSA-N
MW189.26 g/mol
LogP1.51
Rot. Bonds2

About 2-(4-methyl-1,3-thiazol-5-yl)-2-sulfanylacetic acid

2-(4-methyl-1,3-thiazol-5-yl)-2-sulfanylacetic acid (PubChem CID 21298330) has the molecular formula C6H7NO2S2 and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-5-yl)-2-sulfanylacetic acid.

Molecular Properties

Compound Name2-(4-methyl-1,3-thiazol-5-yl)-2-sulfanylacetic acid
PubChem CID21298330
Molecular FormulaC6H7NO2S2
Molecular Weight189.26 g/mol
Exact Mass188.99
IUPAC Name2-(4-methyl-1,3-thiazol-5-yl)-2-sulfanylacetic acid
SMILESCc1ncsc1C(S)C(=O)O
InChIInChI=1S/C6H7NO2S2/c1-3-5(11-2-7-3)4(10)6(8)9/h2,4,10H,1H3,(H,8,9)
InChIKeyLZOMRFMEUDZCKK-UHFFFAOYSA-N
XLogP1.51
TPSA50.19 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.26
LogP ≤ 51.51
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze 2-(4-methyl-1,3-thiazol-5-yl)-2-sulfanylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-methyl-1,3-thiazol-5-yl)-2-sulfanylacetic acid?
The IUPAC name of 2-(4-methyl-1,3-thiazol-5-yl)-2-sulfanylacetic acid (CID 21298330) is 2-(4-methyl-1,3-thiazol-5-yl)-2-sulfanylacetic acid.
What is the SMILES notation for 2-(4-methyl-1,3-thiazol-5-yl)-2-sulfanylacetic acid?
The canonical SMILES for 2-(4-methyl-1,3-thiazol-5-yl)-2-sulfanylacetic acid is Cc1ncsc1C(S)C(=O)O.
What is the InChIKey of 2-(4-methyl-1,3-thiazol-5-yl)-2-sulfanylacetic acid?
The InChIKey is LZOMRFMEUDZCKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2S2/c1-3-5(11-2-7-3)4(10)6(8)9/h2,4,10H,1H3,(H,8,9).
What are the key properties of 2-(4-methyl-1,3-thiazol-5-yl)-2-sulfanylacetic acid?
2-(4-methyl-1,3-thiazol-5-yl)-2-sulfanylacetic acid has a molecular weight of 189.26 g/mol, XLogP of 1.51, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-1,3-thiazol-5-yl)-2-sulfanylacetic acid is sourced from PubChem (CID 21298330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).