C6H8ClNOS — CID 101008965
(1R)-2-chloro-1-(4-methyl-1,3-thiazol-5-yl)ethanol (PubChem CID 101008965) has the molecular formula C6H8ClNOS and a molecular weight of 177.66 g/mol. Its IUPAC name is (1R)-2-chloro-1-(4-methyl-1,3-thiazol-5-yl)ethanol.
| Compound Name | (1R)-2-chloro-1-(4-methyl-1,3-thiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 101008965 |
| Molecular Formula | C6H8ClNOS |
| Molecular Weight | 177.66 g/mol |
| Exact Mass | 177.00 |
| IUPAC Name | (1R)-2-chloro-1-(4-methyl-1,3-thiazol-5-yl)ethanol |
| SMILES | Cc1ncsc1[C@@H](O)CCl |
| InChI | InChI=1S/C6H8ClNOS/c1-4-6(5(9)2-7)10-3-8-4/h3,5,9H,2H2,1H3/t5-/m0/s1 |
| InChIKey | OOKATFCTRGAPQX-YFKPBYRVSA-N |
| XLogP | 1.72 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.66 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|