C11H17NOS — CID 105090377
2-cyclopentyl-1-(4-methyl-1,3-thiazol-5-yl)ethanol (PubChem CID 105090377) has the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. Its IUPAC name is 2-cyclopentyl-1-(4-methyl-1,3-thiazol-5-yl)ethanol.
| Compound Name | 2-cyclopentyl-1-(4-methyl-1,3-thiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 105090377 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-cyclopentyl-1-(4-methyl-1,3-thiazol-5-yl)ethanol |
| SMILES | Cc1ncsc1C(O)CC1CCCC1 |
| InChI | InChI=1S/C11H17NOS/c1-8-11(14-7-12-8)10(13)6-9-4-2-3-5-9/h7,9-10,13H,2-6H2,1H3 |
| InChIKey | MGKAGEZBGVYPKI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |