C11H19NOS — CID 105122728
5-methyl-1-(4-methyl-1,3-thiazol-5-yl)hexan-1-ol (PubChem CID 105122728) has the molecular formula C11H19NOS and a molecular weight of 213.35 g/mol. Its IUPAC name is 5-methyl-1-(4-methyl-1,3-thiazol-5-yl)hexan-1-ol.
| Compound Name | 5-methyl-1-(4-methyl-1,3-thiazol-5-yl)hexan-1-ol |
|---|---|
| PubChem CID | 105122728 |
| Molecular Formula | C11H19NOS |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 5-methyl-1-(4-methyl-1,3-thiazol-5-yl)hexan-1-ol |
| SMILES | Cc1ncsc1C(O)CCCC(C)C |
| InChI | InChI=1S/C11H19NOS/c1-8(2)5-4-6-10(13)11-9(3)12-7-14-11/h7-8,10,13H,4-6H2,1-3H3 |
| InChIKey | LWMUSYZHWLTQNT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |