C16H30N2S — CID 105138249
N-methyl-1-(4-methyl-1,3-thiazol-5-yl)undecan-1-amine (PubChem CID 105138249) has the molecular formula C16H30N2S and a molecular weight of 282.50 g/mol. Its IUPAC name is N-methyl-1-(4-methyl-1,3-thiazol-5-yl)undecan-1-amine.
| Compound Name | N-methyl-1-(4-methyl-1,3-thiazol-5-yl)undecan-1-amine |
|---|---|
| PubChem CID | 105138249 |
| Molecular Formula | C16H30N2S |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N-methyl-1-(4-methyl-1,3-thiazol-5-yl)undecan-1-amine |
| SMILES | CCCCCCCCCCC(NC)c1scnc1C |
| InChI | InChI=1S/C16H30N2S/c1-4-5-6-7-8-9-10-11-12-15(17-3)16-14(2)18-13-19-16/h13,15,17H,4-12H2,1-3H3 |
| InChIKey | LDAUIRPCTSXSCE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|