C11H20N2S — CID 105125558
N-ethyl-1-(4-methyl-1,3-thiazol-5-yl)pentan-1-amine (PubChem CID 105125558) has the molecular formula C11H20N2S and a molecular weight of 212.36 g/mol. Its IUPAC name is N-ethyl-1-(4-methyl-1,3-thiazol-5-yl)pentan-1-amine.
| Compound Name | N-ethyl-1-(4-methyl-1,3-thiazol-5-yl)pentan-1-amine |
|---|---|
| PubChem CID | 105125558 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | N-ethyl-1-(4-methyl-1,3-thiazol-5-yl)pentan-1-amine |
| SMILES | CCCCC(NCC)c1scnc1C |
| InChI | InChI=1S/C11H20N2S/c1-4-6-7-10(12-5-2)11-9(3)13-8-14-11/h8,10,12H,4-7H2,1-3H3 |
| InChIKey | NRXSMIJZEXFPCO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |