C10H14N2S — CID 105112701
N-methyl-1-(4-methyl-1,3-thiazol-5-yl)pent-3-yn-1-amine (PubChem CID 105112701) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is N-methyl-1-(4-methyl-1,3-thiazol-5-yl)pent-3-yn-1-amine.
| Compound Name | N-methyl-1-(4-methyl-1,3-thiazol-5-yl)pent-3-yn-1-amine |
|---|---|
| PubChem CID | 105112701 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | N-methyl-1-(4-methyl-1,3-thiazol-5-yl)pent-3-yn-1-amine |
| SMILES | CC#CCC(NC)c1scnc1C |
| InChI | InChI=1S/C10H14N2S/c1-4-5-6-9(11-3)10-8(2)12-7-13-10/h7,9,11H,6H2,1-3H3 |
| InChIKey | NHPBAQMEWTZGAQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|