C8H10N2S — CID 105158458
N-methyl-1-(4-methyl-1,3-thiazol-5-yl)prop-2-yn-1-amine (PubChem CID 105158458) has the molecular formula C8H10N2S and a molecular weight of 166.25 g/mol. Its IUPAC name is N-methyl-1-(4-methyl-1,3-thiazol-5-yl)prop-2-yn-1-amine.
| Compound Name | N-methyl-1-(4-methyl-1,3-thiazol-5-yl)prop-2-yn-1-amine |
|---|---|
| PubChem CID | 105158458 |
| Molecular Formula | C8H10N2S |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | N-methyl-1-(4-methyl-1,3-thiazol-5-yl)prop-2-yn-1-amine |
| SMILES | C#CC(NC)c1scnc1C |
| InChI | InChI=1S/C8H10N2S/c1-4-7(9-3)8-6(2)10-5-11-8/h1,5,7,9H,2-3H3 |
| InChIKey | SHXWLMXHVLQCMU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|