C9H14N2S — CID 83684010
cyclobutyl-(4-methyl-1,3-thiazol-5-yl)methanamine (PubChem CID 83684010) has the molecular formula C9H14N2S and a molecular weight of 182.29 g/mol. Its IUPAC name is cyclobutyl-(4-methyl-1,3-thiazol-5-yl)methanamine.
| Compound Name | cyclobutyl-(4-methyl-1,3-thiazol-5-yl)methanamine |
|---|---|
| PubChem CID | 83684010 |
| Molecular Formula | C9H14N2S |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | cyclobutyl-(4-methyl-1,3-thiazol-5-yl)methanamine |
| SMILES | Cc1ncsc1C(N)C1CCC1 |
| InChI | InChI=1S/C9H14N2S/c1-6-9(12-5-11-6)8(10)7-3-2-4-7/h5,7-8H,2-4,10H2,1H3 |
| InChIKey | CKMDJNSNIYPNOK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |