C10H13N3OS — CID 105081796
(1-ethylpyrazol-4-yl)-(4-methyl-1,3-thiazol-5-yl)methanol (PubChem CID 105081796) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is (1-ethylpyrazol-4-yl)-(4-methyl-1,3-thiazol-5-yl)methanol.
| Compound Name | (1-ethylpyrazol-4-yl)-(4-methyl-1,3-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 105081796 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | (1-ethylpyrazol-4-yl)-(4-methyl-1,3-thiazol-5-yl)methanol |
| SMILES | CCn1cc(C(O)c2scnc2C)cn1 |
| InChI | InChI=1S/C10H13N3OS/c1-3-13-5-8(4-12-13)9(14)10-7(2)11-6-15-10/h4-6,9,14H,3H2,1-2H3 |
| InChIKey | BXHLISKRCCHKLH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |