C11H10FNOS — CID 22101844
(4-fluorophenyl)-(4-methyl-1,3-thiazol-5-yl)methanol (PubChem CID 22101844) has the molecular formula C11H10FNOS and a molecular weight of 223.27 g/mol. Its IUPAC name is (4-fluorophenyl)-(4-methyl-1,3-thiazol-5-yl)methanol.
| Compound Name | (4-fluorophenyl)-(4-methyl-1,3-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 22101844 |
| Molecular Formula | C11H10FNOS |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | (4-fluorophenyl)-(4-methyl-1,3-thiazol-5-yl)methanol |
| SMILES | Cc1ncsc1C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H10FNOS/c1-7-11(15-6-13-7)10(14)8-2-4-9(12)5-3-8/h2-6,10,14H,1H3 |
| InChIKey | HSVJLQSKVZGAHS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |