C14H17NO3S — CID 105125520
[2-(2-methoxyethoxy)phenyl]-(4-methyl-1,3-thiazol-5-yl)methanol (PubChem CID 105125520) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is [2-(2-methoxyethoxy)phenyl]-(4-methyl-1,3-thiazol-5-yl)methanol.
| Compound Name | [2-(2-methoxyethoxy)phenyl]-(4-methyl-1,3-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 105125520 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | [2-(2-methoxyethoxy)phenyl]-(4-methyl-1,3-thiazol-5-yl)methanol |
| SMILES | COCCOc1ccccc1C(O)c1scnc1C |
| InChI | InChI=1S/C14H17NO3S/c1-10-14(19-9-15-10)13(16)11-5-3-4-6-12(11)18-8-7-17-2/h3-6,9,13,16H,7-8H2,1-2H3 |
| InChIKey | QSXWRIIXLZWCDM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|