C11H9Cl2NOS — CID 22101852
(2,4-dichlorophenyl)-(4-methyl-1,3-thiazol-5-yl)methanol (PubChem CID 22101852) has the molecular formula C11H9Cl2NOS and a molecular weight of 274.17 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-(4-methyl-1,3-thiazol-5-yl)methanol.
| Compound Name | (2,4-dichlorophenyl)-(4-methyl-1,3-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 22101852 |
| Molecular Formula | C11H9Cl2NOS |
| Molecular Weight | 274.17 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | (2,4-dichlorophenyl)-(4-methyl-1,3-thiazol-5-yl)methanol |
| SMILES | Cc1ncsc1C(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H9Cl2NOS/c1-6-11(16-5-14-6)10(15)8-3-2-7(12)4-9(8)13/h2-5,10,15H,1H3 |
| InChIKey | KUHXNVTZOGNIDN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.17 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |