C13H16N2O2S — CID 105141195
(3,4-dimethoxyphenyl)-(4-methyl-1,3-thiazol-5-yl)methanamine (PubChem CID 105141195) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-(4-methyl-1,3-thiazol-5-yl)methanamine.
| Compound Name | (3,4-dimethoxyphenyl)-(4-methyl-1,3-thiazol-5-yl)methanamine |
|---|---|
| PubChem CID | 105141195 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | (3,4-dimethoxyphenyl)-(4-methyl-1,3-thiazol-5-yl)methanamine |
| SMILES | COc1ccc(C(N)c2scnc2C)cc1OC |
| InChI | InChI=1S/C13H16N2O2S/c1-8-13(18-7-15-8)12(14)9-4-5-10(16-2)11(6-9)17-3/h4-7,12H,14H2,1-3H3 |
| InChIKey | PDCIHOMFHZCRFI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |