C14H17N3O2S — CID 43789045
4-methoxy-3-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]benzamide (PubChem CID 43789045) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 4-methoxy-3-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]benzamide.
| Compound Name | 4-methoxy-3-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]benzamide |
|---|---|
| PubChem CID | 43789045 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 4-methoxy-3-[1-(4-methyl-1,3-thiazol-5-yl)ethylamino]benzamide |
| SMILES | COc1ccc(C(N)=O)cc1NC(C)c1scnc1C |
| InChI | InChI=1S/C14H17N3O2S/c1-8-13(20-7-16-8)9(2)17-11-6-10(14(15)18)4-5-12(11)19-3/h4-7,9,17H,1-3H3,(H2,15,18) |
| InChIKey | KAHWOVKUZNXUKT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |