C14H15F3N2OS — CID 43779859
4-methoxy-N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]-2-(trifluoromethyl)aniline (PubChem CID 43779859) has the molecular formula C14H15F3N2OS and a molecular weight of 316.35 g/mol. Its IUPAC name is 4-methoxy-N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]-2-(trifluoromethyl)aniline.
| Compound Name | 4-methoxy-N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 43779859 |
| Molecular Formula | C14H15F3N2OS |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 4-methoxy-N-[1-(4-methyl-1,3-thiazol-5-yl)ethyl]-2-(trifluoromethyl)aniline |
| SMILES | COc1ccc(NC(C)c2scnc2C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H15F3N2OS/c1-8-13(21-7-18-8)9(2)19-12-5-4-10(20-3)6-11(12)14(15,16)17/h4-7,9,19H,1-3H3 |
| InChIKey | IZMUHTYKLXARPB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|