C11H15F3N2O — CID 103388027
2-N-[4-methoxy-2-(trifluoromethyl)phenyl]propane-1,2-diamine (PubChem CID 103388027) has the molecular formula C11H15F3N2O and a molecular weight of 248.25 g/mol. Its IUPAC name is 2-N-[4-methoxy-2-(trifluoromethyl)phenyl]propane-1,2-diamine.
| Compound Name | 2-N-[4-methoxy-2-(trifluoromethyl)phenyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 103388027 |
| Molecular Formula | C11H15F3N2O |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 2-N-[4-methoxy-2-(trifluoromethyl)phenyl]propane-1,2-diamine |
| SMILES | COc1ccc(NC(C)CN)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H15F3N2O/c1-7(6-15)16-10-4-3-8(17-2)5-9(10)11(12,13)14/h3-5,7,16H,6,15H2,1-2H3 |
| InChIKey | LQOHGIZTKCPJHL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|