C11H14ClF4NO — CID 171227736
(1S)-3-fluoro-1-[4-methoxy-2-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride (PubChem CID 171227736) has the molecular formula C11H14ClF4NO and a molecular weight of 287.68 g/mol. Its IUPAC name is (1S)-3-fluoro-1-[4-methoxy-2-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride.
| Compound Name | (1S)-3-fluoro-1-[4-methoxy-2-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171227736 |
| Molecular Formula | C11H14ClF4NO |
| Molecular Weight | 287.68 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | (1S)-3-fluoro-1-[4-methoxy-2-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride |
| SMILES | COc1ccc([C@@H](N)CCF)c(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C11H13F4NO.ClH/c1-17-7-2-3-8(10(16)4-5-12)9(6-7)11(13,14)15;/h2-3,6,10H,4-5,16H2,1H3;1H/t10-;/m0./s1 |
| InChIKey | GPYFHYYWSLCSJS-PPHPATTJSA-N |
| XLogP | 3.50 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.68 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |