C11H18N2O4S2 — CID 122070083
2-[2-(4-methyl-1,3-thiazol-5-yl)ethylsulfonylamino]pentanoic acid (PubChem CID 122070083) has the molecular formula C11H18N2O4S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-[2-(4-methyl-1,3-thiazol-5-yl)ethylsulfonylamino]pentanoic acid.
| Compound Name | 2-[2-(4-methyl-1,3-thiazol-5-yl)ethylsulfonylamino]pentanoic acid |
|---|---|
| PubChem CID | 122070083 |
| Molecular Formula | C11H18N2O4S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2-[2-(4-methyl-1,3-thiazol-5-yl)ethylsulfonylamino]pentanoic acid |
| SMILES | CCCC(NS(=O)(=O)CCc1scnc1C)C(=O)O |
| InChI | InChI=1S/C11H18N2O4S2/c1-3-4-9(11(14)15)13-19(16,17)6-5-10-8(2)12-7-18-10/h7,9,13H,3-6H2,1-2H3,(H,14,15) |
| InChIKey | DBSLLYIDIBCGIB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |