C12H22N2S — CID 62528685
2-methyl-4-(4-methyl-1,3-thiazol-5-yl)-N-propylbutan-1-amine (PubChem CID 62528685) has the molecular formula C12H22N2S and a molecular weight of 226.39 g/mol. Its IUPAC name is 2-methyl-4-(4-methyl-1,3-thiazol-5-yl)-N-propylbutan-1-amine.
| Compound Name | 2-methyl-4-(4-methyl-1,3-thiazol-5-yl)-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 62528685 |
| Molecular Formula | C12H22N2S |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 2-methyl-4-(4-methyl-1,3-thiazol-5-yl)-N-propylbutan-1-amine |
| SMILES | CCCNCC(C)CCc1scnc1C |
| InChI | InChI=1S/C12H22N2S/c1-4-7-13-8-10(2)5-6-12-11(3)14-9-15-12/h9-10,13H,4-8H2,1-3H3 |
| InChIKey | LDYQXCZSDKREAJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|