C6H9Br2NS — CID 70095117
5-(2-bromoethyl)-4-methyl-1,3-thiazole;hydrobromide (PubChem CID 70095117) has the molecular formula C6H9Br2NS and a molecular weight of 287.02 g/mol. Its IUPAC name is 5-(2-bromoethyl)-4-methyl-1,3-thiazole;hydrobromide.
| Compound Name | 5-(2-bromoethyl)-4-methyl-1,3-thiazole;hydrobromide |
|---|---|
| PubChem CID | 70095117 |
| Molecular Formula | C6H9Br2NS |
| Molecular Weight | 287.02 g/mol |
| Exact Mass | 284.88 |
| IUPAC Name | 5-(2-bromoethyl)-4-methyl-1,3-thiazole;hydrobromide |
| SMILES | Br.Cc1ncsc1CCBr |
| InChI | InChI=1S/C6H8BrNS.BrH/c1-5-6(2-3-7)9-4-8-5;/h4H,2-3H2,1H3;1H |
| InChIKey | BHBQCSAJEKMSPN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.02 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|