C12H16N3O3S2+ — CID 66636338
bis[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-oxoazanium (PubChem CID 66636338) has the molecular formula C12H16N3O3S2+ and a molecular weight of 314.41 g/mol. Its IUPAC name is bis[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-oxoazanium.
| Compound Name | bis[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-oxoazanium |
|---|---|
| PubChem CID | 66636338 |
| Molecular Formula | C12H16N3O3S2+ |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | bis[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-oxoazanium |
| SMILES | Cc1ncsc1CCO[N+](=O)OCCc1scnc1C |
| InChI | InChI=1S/C12H16N3O3S2/c1-9-11(19-7-13-9)3-5-17-15(16)18-6-4-12-10(2)14-8-20-12/h7-8H,3-6H2,1-2H3/q+1 |
| InChIKey | UXGPSDUMVRRMNL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|