C10H10IN3OS — CID 116649153
5-[2-(5-iodopyrimidin-2-yl)oxyethyl]-4-methyl-1,3-thiazole (PubChem CID 116649153) has the molecular formula C10H10IN3OS and a molecular weight of 347.18 g/mol. Its IUPAC name is 5-[2-(5-iodopyrimidin-2-yl)oxyethyl]-4-methyl-1,3-thiazole.
| Compound Name | 5-[2-(5-iodopyrimidin-2-yl)oxyethyl]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 116649153 |
| Molecular Formula | C10H10IN3OS |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 346.96 |
| IUPAC Name | 5-[2-(5-iodopyrimidin-2-yl)oxyethyl]-4-methyl-1,3-thiazole |
| SMILES | Cc1ncsc1CCOc1ncc(I)cn1 |
| InChI | InChI=1S/C10H10IN3OS/c1-7-9(16-6-14-7)2-3-15-10-12-4-8(11)5-13-10/h4-6H,2-3H2,1H3 |
| InChIKey | VZDKYFXEIFYQNI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|