C9H18N2S2 — CID 136948828
4,5-dimethyl-N-(2-methylsulfanylethyl)-1,3-thiazinan-2-imine (PubChem CID 136948828) has the molecular formula C9H18N2S2 and a molecular weight of 218.39 g/mol. Its IUPAC name is 4,5-dimethyl-N-(2-methylsulfanylethyl)-1,3-thiazinan-2-imine.
| Compound Name | 4,5-dimethyl-N-(2-methylsulfanylethyl)-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136948828 |
| Molecular Formula | C9H18N2S2 |
| Molecular Weight | 218.39 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 4,5-dimethyl-N-(2-methylsulfanylethyl)-1,3-thiazinan-2-imine |
| SMILES | CSCC/N=C1/NC(C)C(C)CS1 |
| InChI | InChI=1S/C9H18N2S2/c1-7-6-13-9(11-8(7)2)10-4-5-12-3/h7-8H,4-6H2,1-3H3,(H,10,11) |
| InChIKey | HHNVDBXLFUFBBJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|