C12H20N4S — CID 136948900
4,5-dimethyl-N-(3-pyrazol-1-ylpropyl)-1,3-thiazinan-2-imine (PubChem CID 136948900) has the molecular formula C12H20N4S and a molecular weight of 252.39 g/mol. Its IUPAC name is 4,5-dimethyl-N-(3-pyrazol-1-ylpropyl)-1,3-thiazinan-2-imine.
| Compound Name | 4,5-dimethyl-N-(3-pyrazol-1-ylpropyl)-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136948900 |
| Molecular Formula | C12H20N4S |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 4,5-dimethyl-N-(3-pyrazol-1-ylpropyl)-1,3-thiazinan-2-imine |
| SMILES | CC1CS/C(=N\CCCn2cccn2)NC1C |
| InChI | InChI=1S/C12H20N4S/c1-10-9-17-12(15-11(10)2)13-5-3-7-16-8-4-6-14-16/h4,6,8,10-11H,3,5,7,9H2,1-2H3,(H,13,15) |
| InChIKey | RQFORNUCRDLHCN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|