C6H8N4O — CID 63330175
3-(2-isocyanatoethyl)-4-methyl-1,2,4-triazole (PubChem CID 63330175) has the molecular formula C6H8N4O and a molecular weight of 152.16 g/mol. Its IUPAC name is 3-(2-isocyanatoethyl)-4-methyl-1,2,4-triazole.
| Compound Name | 3-(2-isocyanatoethyl)-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 63330175 |
| Molecular Formula | C6H8N4O |
| Molecular Weight | 152.16 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 3-(2-isocyanatoethyl)-4-methyl-1,2,4-triazole |
| SMILES | Cn1cnnc1CCN=C=O |
| InChI | InChI=1S/C6H8N4O/c1-10-4-8-9-6(10)2-3-7-5-11/h4H,2-3H2,1H3 |
| InChIKey | CLFBTGIDPXEBAF-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.16 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|