C9H17N7 — CID 104886245
1-amino-3-cyclopropyl-2-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]guanidine (PubChem CID 104886245) has the molecular formula C9H17N7 and a molecular weight of 223.28 g/mol. Its IUPAC name is 1-amino-3-cyclopropyl-2-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]guanidine.
| Compound Name | 1-amino-3-cyclopropyl-2-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 104886245 |
| Molecular Formula | C9H17N7 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | 1-amino-3-cyclopropyl-2-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]guanidine |
| SMILES | Cn1cnnc1CC/N=C(\NN)NC1CC1 |
| InChI | InChI=1S/C9H17N7/c1-16-6-12-15-8(16)4-5-11-9(14-10)13-7-2-3-7/h6-7H,2-5,10H2,1H3,(H2,11,13,14) |
| InChIKey | ZJIKJMZFSRZIFY-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 93.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|