C6H12N6S — CID 63330192
1-amino-3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]thiourea (PubChem CID 63330192) has the molecular formula C6H12N6S and a molecular weight of 200.27 g/mol. Its IUPAC name is 1-amino-3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]thiourea.
| Compound Name | 1-amino-3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 63330192 |
| Molecular Formula | C6H12N6S |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 1-amino-3-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]thiourea |
| SMILES | Cn1cnnc1CCNC(=S)NN |
| InChI | InChI=1S/C6H12N6S/c1-12-4-9-11-5(12)2-3-8-6(13)10-7/h4H,2-3,7H2,1H3,(H2,8,10,13) |
| InChIKey | WDQKRVYDNHRSLU-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 80.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|